C11H17F3N2S — CID 115410588
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115410588) has the molecular formula C11H17F3N2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115410588 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | Cc1nc(C(C)NCCCC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C11H17F3N2S/c1-7(10-8(2)17-9(3)16-10)15-6-4-5-11(12,13)14/h7,15H,4-6H2,1-3H3 |
| InChIKey | VKGWOGOECBEOJG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|