C30H41FN4O4 — CID 11541143
(3R,6S,9R,12R)-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione (PubChem CID 11541143) has the molecular formula C30H41FN4O4 and a molecular weight of 540.68 g/mol. Its IUPAC name is (3R,6S,9R,12R)-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
|---|---|
| PubChem CID | 11541143 |
| Molecular Formula | C30H41FN4O4 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (3R,6S,9R,12R)-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-6-propyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-7,10,13-trione |
| SMILES | CCC[C@@H]1NC[C@@H](C)Oc2ccccc2CCCNC(=O)[C@@H](Cc2ccc(F)cc2)NC(=O)[C@@H](C)N(C)C1=O |
| InChI | InChI=1S/C30H41FN4O4/c1-5-9-25-30(38)35(4)21(3)28(36)34-26(18-22-13-15-24(31)16-14-22)29(37)32-17-8-11-23-10-6-7-12-27(23)39-20(2)19-33-25/h6-7,10,12-16,20-21,25-26,33H,5,8-9,11,17-19H2,1-4H3,(H,32,37)(H,34,36)/t20-,21-,25+,26-/m1/s1 |
| InChIKey | QSWZCBJMPATZGX-YTFNCPKPSA-N |
| XLogP | 2.99 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |