C34H33N3O4 — CID 11541225
methyl (2S)-2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoate (PubChem CID 11541225) has the molecular formula C34H33N3O4 and a molecular weight of 547.65 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 11541225 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.65 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | methyl (2S)-2-[[(2S,3aR,8bS)-8b-hydroxy-3-trityl-1,2,3a,4-tetrahydropyrrolo[2,3-b]indole-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@@H]1C[C@]2(O)c3ccccc3N[C@@H]2N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H33N3O4/c1-23(31(39)41-2)35-30(38)29-22-33(40)27-20-12-13-21-28(27)36-32(33)37(29)34(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-21,23,29,32,36,40H,22H2,1-2H3,(H,35,38)/t23-,29-,32+,33-/m0/s1 |
| InChIKey | DFVVSBNXXGPMAJ-CQAOEFNFSA-N |
| XLogP | 4.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|