C30H42F3NO3Si — CID 11541249
[(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]-trimethylsilane (PubChem CID 11541249) has the molecular formula C30H42F3NO3Si and a molecular weight of 549.75 g/mol. Its IUPAC name is [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]-trimethylsilane.
| Compound Name | [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11541249 |
| Molecular Formula | C30H42F3NO3Si |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | [(1S)-1-[(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-2,2,2-trifluoro-1-(4-methoxyphenyl)ethoxy]-trimethylsilane |
| SMILES | COc1ccc([C@](O[Si](C)(C)C)([C@@H]2O[C@@H]3C[C@H](C)CC[C@H]3C(C)(C)N2Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H42F3NO3Si/c1-21-13-18-25-26(19-21)36-27(34(28(25,2)3)20-22-11-9-8-10-12-22)29(30(31,32)33,37-38(5,6)7)23-14-16-24(35-4)17-15-23/h8-12,14-17,21,25-27H,13,18-20H2,1-7H3/t21-,25-,26-,27+,29+/m1/s1 |
| InChIKey | RMWJRVZJXUCICG-RGFKXKKOSA-N |
| XLogP | 7.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|