C15H22N2O2 — CID 115413065
2-amino-N-(cyclopropylmethyl)-4-methoxy-N-propan-2-ylbenzamide (PubChem CID 115413065) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-amino-N-(cyclopropylmethyl)-4-methoxy-N-propan-2-ylbenzamide.
| Compound Name | 2-amino-N-(cyclopropylmethyl)-4-methoxy-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 115413065 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-amino-N-(cyclopropylmethyl)-4-methoxy-N-propan-2-ylbenzamide |
| SMILES | COc1ccc(C(=O)N(CC2CC2)C(C)C)c(N)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)17(9-11-4-5-11)15(18)13-7-6-12(19-3)8-14(13)16/h6-8,10-11H,4-5,9,16H2,1-3H3 |
| InChIKey | WPLYJUFYEIMGFV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|