C30H38F2N4O4 — CID 11541319
(3R,6S,9R,12R)-6-cyclopropyl-21-fluoro-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione (PubChem CID 11541319) has the molecular formula C30H38F2N4O4 and a molecular weight of 556.65 g/mol. Its IUPAC name is (3R,6S,9R,12R)-6-cyclopropyl-21-fluoro-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione.
| Compound Name | (3R,6S,9R,12R)-6-cyclopropyl-21-fluoro-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
|---|---|
| PubChem CID | 11541319 |
| Molecular Formula | C30H38F2N4O4 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (3R,6S,9R,12R)-6-cyclopropyl-21-fluoro-12-[(4-fluorophenyl)methyl]-3,8,9-trimethyl-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-triene-7,10,13-trione |
| SMILES | C[C@@H]1CN[C@@H](C2CC2)C(=O)N(C)[C@H](C)C(=O)N[C@H](Cc2ccc(F)cc2)C(=O)NCCCc2ccc(F)cc2O1 |
| InChI | InChI=1S/C30H38F2N4O4/c1-18-17-34-27(22-8-9-22)30(39)36(3)19(2)28(37)35-25(15-20-6-11-23(31)12-7-20)29(38)33-14-4-5-21-10-13-24(32)16-26(21)40-18/h6-7,10-13,16,18-19,22,25,27,34H,4-5,8-9,14-15,17H2,1-3H3,(H,33,38)(H,35,37)/t18-,19-,25-,27+/m1/s1 |
| InChIKey | IEAUXEJFKGIBRN-IFGWQFMBSA-N |
| XLogP | 2.74 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |