C30H37N3O8 — CID 11541428
benzyl (2S)-5-[[(2R,3S)-4-oxo-3-propyloxetane-2-carbonyl]amino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate (PubChem CID 11541428) has the molecular formula C30H37N3O8 and a molecular weight of 567.64 g/mol. Its IUPAC name is benzyl (2S)-5-[[(2R,3S)-4-oxo-3-propyloxetane-2-carbonyl]amino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate.
| Compound Name | benzyl (2S)-5-[[(2R,3S)-4-oxo-3-propyloxetane-2-carbonyl]amino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 11541428 |
| Molecular Formula | C30H37N3O8 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | benzyl (2S)-5-[[(2R,3S)-4-oxo-3-propyloxetane-2-carbonyl]amino]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoate |
| SMILES | CCC[C@@H]1C(=O)O[C@H]1C(=O)NCCC[C@H](NC(=O)[C@H](C)NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H37N3O8/c1-3-11-23-25(41-28(23)36)27(35)31-17-10-16-24(29(37)39-18-21-12-6-4-7-13-21)33-26(34)20(2)32-30(38)40-19-22-14-8-5-9-15-22/h4-9,12-15,20,23-25H,3,10-11,16-19H2,1-2H3,(H,31,35)(H,32,38)(H,33,34)/t20-,23-,24-,25+/m0/s1 |
| InChIKey | LYBGSJVQPXDWND-WAABAYLZSA-N |
| XLogP | 2.77 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|