C11H18N4O — CID 115414459
2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidin-6-one (PubChem CID 115414459) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 115414459 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidin-6-one |
| SMILES | CN1CCN(C)C(Cc2nccc(=O)[nH]2)C1 |
| InChI | InChI=1S/C11H18N4O/c1-14-5-6-15(2)9(8-14)7-10-12-4-3-11(16)13-10/h3-4,9H,5-8H2,1-2H3,(H,12,13,16) |
| InChIKey | IODFDKWSMICLNI-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |