C12H12FN3 — CID 115416333
N-(2,5-dimethylphenyl)-6-fluoropyrimidin-4-amine (PubChem CID 115416333) has the molecular formula C12H12FN3 and a molecular weight of 217.25 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-6-fluoropyrimidin-4-amine.
| Compound Name | N-(2,5-dimethylphenyl)-6-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 115416333 |
| Molecular Formula | C12H12FN3 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-6-fluoropyrimidin-4-amine |
| SMILES | Cc1ccc(C)c(Nc2cc(F)ncn2)c1 |
| InChI | InChI=1S/C12H12FN3/c1-8-3-4-9(2)10(5-8)16-12-6-11(13)14-7-15-12/h3-7H,1-2H3,(H,14,15,16) |
| InChIKey | PZZSDEJNVIRMAM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |