C36H52O5Si — CID 11541653
[(1R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexan-3-yl] hex-5-enoate (PubChem CID 11541653) has the molecular formula C36H52O5Si and a molecular weight of 592.89 g/mol. Its IUPAC name is [(1R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexan-3-yl] hex-5-enoate.
| Compound Name | [(1R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexan-3-yl] hex-5-enoate |
|---|---|
| PubChem CID | 11541653 |
| Molecular Formula | C36H52O5Si |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | [(1R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexan-3-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@H](CCC)C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C36H52O5Si/c1-6-8-12-24-34(37)39-29(19-7-2)27-32(33-28-38-36(40-33)25-17-11-18-26-36)41-42(35(3,4)5,30-20-13-9-14-21-30)31-22-15-10-16-23-31/h6,9-10,13-16,20-23,29,32-33H,1,7-8,11-12,17-19,24-28H2,2-5H3/t29-,32-,33-/m1/s1 |
| InChIKey | YSEBBZDRSYLEBW-KTCJXSDQSA-N |
| XLogP | 7.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|