C13H18FN3 — CID 115416560
1-(6-fluoropyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 115416560) has the molecular formula C13H18FN3 and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-(6-fluoropyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(6-fluoropyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 115416560 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-(6-fluoropyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | Fc1cc(N2CCCC3CCCCC32)ncn1 |
| InChI | InChI=1S/C13H18FN3/c14-12-8-13(16-9-15-12)17-7-3-5-10-4-1-2-6-11(10)17/h8-11H,1-7H2 |
| InChIKey | JOCXLJLDIGLRLI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |