C11H12FN3O — CID 115416612
N-ethyl-6-fluoro-N-(furan-2-ylmethyl)pyrimidin-4-amine (PubChem CID 115416612) has the molecular formula C11H12FN3O and a molecular weight of 221.24 g/mol. Its IUPAC name is N-ethyl-6-fluoro-N-(furan-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-6-fluoro-N-(furan-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 115416612 |
| Molecular Formula | C11H12FN3O |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-ethyl-6-fluoro-N-(furan-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCN(Cc1ccco1)c1cc(F)ncn1 |
| InChI | InChI=1S/C11H12FN3O/c1-2-15(7-9-4-3-5-16-9)11-6-10(12)13-8-14-11/h3-6,8H,2,7H2,1H3 |
| InChIKey | HCYZBORTJIUQLN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |