C8H7FN6S — CID 115417341
2-(6-fluoropyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine (PubChem CID 115417341) has the molecular formula C8H7FN6S and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(6-fluoropyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-(6-fluoropyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115417341 |
| Molecular Formula | C8H7FN6S |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-(6-fluoropyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(Sc2cc(F)ncn2)n1 |
| InChI | InChI=1S/C8H7FN6S/c9-4-1-7(13-3-12-4)16-8-14-5(10)2-6(11)15-8/h1-3H,(H4,10,11,14,15) |
| InChIKey | LXUQDUDLBXEYNF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |