C14H19NO2 — CID 115417592
(7S)-10-methyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine (PubChem CID 115417592) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (7S)-10-methyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine.
| Compound Name | (7S)-10-methyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine |
|---|---|
| PubChem CID | 115417592 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (7S)-10-methyl-3,4,7,8,9,10-hexahydro-2H-benzo[h][1,5]benzodioxepin-7-amine |
| SMILES | CC1CC[C@H](N)c2cc3c(cc21)OCCCO3 |
| InChI | InChI=1S/C14H19NO2/c1-9-3-4-12(15)11-8-14-13(7-10(9)11)16-5-2-6-17-14/h7-9,12H,2-6,15H2,1H3/t9?,12-/m0/s1 |
| InChIKey | MCDRELDYYUUZGD-ACGXKRRESA-N |
| XLogP | 2.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |