C30H32N2O9S2 — CID 11541867
2-[4-[[5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-2,3-dioxoindol-1-yl]methyl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 11541867) has the molecular formula C30H32N2O9S2 and a molecular weight of 628.73 g/mol. Its IUPAC name is 2-[4-[[5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-2,3-dioxoindol-1-yl]methyl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[[5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-2,3-dioxoindol-1-yl]methyl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11541867 |
| Molecular Formula | C30H32N2O9S2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | 2-[4-[[5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-2,3-dioxoindol-1-yl]methyl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc(OCCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O9S2/c1-21-5-11-25(12-6-21)43(37,38)41-17-16-40-24-9-7-22(8-10-24)19-31-28-14-13-26(18-27(28)29(33)30(31)34)42(35,36)32-15-3-4-23(32)20-39-2/h5-14,18,23H,3-4,15-17,19-20H2,1-2H3/t23-/m0/s1 |
| InChIKey | VXDALODUEXZZKU-QHCPKHFHSA-N |
| XLogP | 3.31 |
| TPSA | 136.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|