C16H21N5 — CID 115419071
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115419071) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115419071 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC1CC(N2CCn3cnnc3C2)C(N)c2ccccc21 |
| InChI | InChI=1S/C16H21N5/c1-11-8-14(16(17)13-5-3-2-4-12(11)13)20-6-7-21-10-18-19-15(21)9-20/h2-5,10-11,14,16H,6-9,17H2,1H3 |
| InChIKey | JYYWYIGTPKEOLJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |