C18H27N3 — CID 115419091
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 115419091) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115419091 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CC1CC(N2CCN3CCCC3C2)C(N)c2ccccc21 |
| InChI | InChI=1S/C18H27N3/c1-13-11-17(18(19)16-7-3-2-6-15(13)16)21-10-9-20-8-4-5-14(20)12-21/h2-3,6-7,13-14,17-18H,4-5,8-12,19H2,1H3 |
| InChIKey | XIEDEPZBUNAOOK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |