C18H28N2O — CID 115419096
2-N-[2-(cyclopropylmethoxy)ethyl]-2-N,4-dimethyl-1,2,3,4-tetrahydronaphthalene-1,2-diamine (PubChem CID 115419096) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-N-[2-(cyclopropylmethoxy)ethyl]-2-N,4-dimethyl-1,2,3,4-tetrahydronaphthalene-1,2-diamine.
| Compound Name | 2-N-[2-(cyclopropylmethoxy)ethyl]-2-N,4-dimethyl-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
|---|---|
| PubChem CID | 115419096 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-N-[2-(cyclopropylmethoxy)ethyl]-2-N,4-dimethyl-1,2,3,4-tetrahydronaphthalene-1,2-diamine |
| SMILES | CC1CC(N(C)CCOCC2CC2)C(N)c2ccccc21 |
| InChI | InChI=1S/C18H28N2O/c1-13-11-17(18(19)16-6-4-3-5-15(13)16)20(2)9-10-21-12-14-7-8-14/h3-6,13-14,17-18H,7-12,19H2,1-2H3 |
| InChIKey | HCBWHVZTQBYIQL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|