About 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole
5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole (PubChem CID 115419371) has the molecular formula C17H21N3S
and a molecular weight of 299.44 g/mol. Its IUPAC name is 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole |
| PubChem CID | 115419371 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole |
| SMILES | CC1Cc2sc(CN3CCNCC3)nc2-c2ccccc21 |
| InChI | InChI=1S/C17H21N3S/c1-12-10-15-17(14-5-3-2-4-13(12)14)19-16(21-15)11-20-8-6-18-7-9-20/h2-5,12,18H,6-11H2,1H3 |
| InChIKey | IRXNNJYTTPVDOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole?
The IUPAC name of 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole (CID 115419371) is 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole.
What is the SMILES notation for 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole?
The canonical SMILES for 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole is CC1Cc2sc(CN3CCNCC3)nc2-c2ccccc21.
What is the InChIKey of 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole?
The InChIKey is IRXNNJYTTPVDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3S/c1-12-10-15-17(14-5-3-2-4-13(12)14)19-16(21-15)11-20-8-6-18-7-9-20/h2-5,12,18H,6-11H2,1H3.
What are the key properties of 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole?
5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole has a molecular weight of 299.44 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(piperazin-1-ylmethyl)-4,5-dihydrobenzo[e][1,3]benzothiazole is sourced from PubChem (CID 115419371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).