C19H29NO — CID 115420102
2-(4-ethylazepan-1-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 115420102) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 2-(4-ethylazepan-1-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 2-(4-ethylazepan-1-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 115420102 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 2-(4-ethylazepan-1-yl)-4-methyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CCC1CCCN(C2CC(C)c3ccccc3C2O)CC1 |
| InChI | InChI=1S/C19H29NO/c1-3-15-7-6-11-20(12-10-15)18-13-14(2)16-8-4-5-9-17(16)19(18)21/h4-5,8-9,14-15,18-19,21H,3,6-7,10-13H2,1-2H3 |
| InChIKey | HVEIRQMAEIMOIV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |