About 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide
5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide (PubChem CID 115420370) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide |
| PubChem CID | 115420370 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide |
| SMILES | CC1CCC(=O)c2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C11H13NO3S/c1-7-2-5-11(13)10-6-8(16(12,14)15)3-4-9(7)10/h3-4,6-7H,2,5H2,1H3,(H2,12,14,15) |
| InChIKey | PDWAGWIQZXNZPL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide?
The IUPAC name of 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide (CID 115420370) is 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide.
What is the SMILES notation for 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide?
The canonical SMILES for 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide is CC1CCC(=O)c2cc(S(N)(=O)=O)ccc21.
What is the InChIKey of 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide?
The InChIKey is PDWAGWIQZXNZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-7-2-5-11(13)10-6-8(16(12,14)15)3-4-9(7)10/h3-4,6-7H,2,5H2,1H3,(H2,12,14,15).
What are the key properties of 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide?
5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide has a molecular weight of 239.30 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-8-oxo-6,7-dihydro-5H-naphthalene-2-sulfonamide is sourced from PubChem (CID 115420370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).