C12H15N — CID 115420913
4-methyl-1,2,2a,3,4,8b-hexahydronaphtho[1,2-b]azete (PubChem CID 115420913) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 4-methyl-1,2,2a,3,4,8b-hexahydronaphtho[1,2-b]azete.
| Compound Name | 4-methyl-1,2,2a,3,4,8b-hexahydronaphtho[1,2-b]azete |
|---|---|
| PubChem CID | 115420913 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4-methyl-1,2,2a,3,4,8b-hexahydronaphtho[1,2-b]azete |
| SMILES | CC1CC2CNC2c2ccccc21 |
| InChI | InChI=1S/C12H15N/c1-8-6-9-7-13-12(9)11-5-3-2-4-10(8)11/h2-5,8-9,12-13H,6-7H2,1H3 |
| InChIKey | KZHGBCAZWSMBRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |