C45H58O4Si — CID 11542111
(2S)-2-[(2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-1-phenylmethoxy-5-trityloxypentan-2-yl]cyclohexan-1-one (PubChem CID 11542111) has the molecular formula C45H58O4Si and a molecular weight of 691.04 g/mol. Its IUPAC name is (2S)-2-[(2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-1-phenylmethoxy-5-trityloxypentan-2-yl]cyclohexan-1-one.
| Compound Name | (2S)-2-[(2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-1-phenylmethoxy-5-trityloxypentan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11542111 |
| Molecular Formula | C45H58O4Si |
| Molecular Weight | 691.04 g/mol |
| Exact Mass | 690.41 |
| IUPAC Name | (2S)-2-[(2R,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-1-phenylmethoxy-5-trityloxypentan-2-yl]cyclohexan-1-one |
| SMILES | C[C@H]([C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C)[C@@](C)(COCc1ccccc1)[C@@H]1CCCCC1=O |
| InChI | InChI=1S/C45H58O4Si/c1-35(44(5,40-30-20-21-31-41(40)46)34-47-32-36-22-12-8-13-23-36)42(49-50(6,7)43(2,3)4)33-48-45(37-24-14-9-15-25-37,38-26-16-10-17-27-38)39-28-18-11-19-29-39/h8-19,22-29,35,40,42H,20-21,30-34H2,1-7H3/t35-,40-,42-,44-/m1/s1 |
| InChIKey | SMIRNUKKMJITEX-NMOLOEABSA-N |
| XLogP | 11.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.04 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|