C13H20FN3O3S — CID 115421457
2-[(3-amino-4-fluoro-5-methylphenyl)sulfonylamino]-N-propylpropanamide (PubChem CID 115421457) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[(3-amino-4-fluoro-5-methylphenyl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 2-[(3-amino-4-fluoro-5-methylphenyl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 115421457 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(3-amino-4-fluoro-5-methylphenyl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NS(=O)(=O)c1cc(C)c(F)c(N)c1 |
| InChI | InChI=1S/C13H20FN3O3S/c1-4-5-16-13(18)9(3)17-21(19,20)10-6-8(2)12(14)11(15)7-10/h6-7,9,17H,4-5,15H2,1-3H3,(H,16,18) |
| InChIKey | TWNVDTZOIMSJGI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|