C39H50N4O9 — CID 11542193
benzyl 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetate (PubChem CID 11542193) has the molecular formula C39H50N4O9 and a molecular weight of 718.85 g/mol. Its IUPAC name is benzyl 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetate.
| Compound Name | benzyl 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetate |
|---|---|
| PubChem CID | 11542193 |
| Molecular Formula | C39H50N4O9 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | benzyl 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetate |
| SMILES | CCCC(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C1CCCCC1)NC(=O)Cc1cccc(c1)OCCCO2)C(=O)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H50N4O9/c1-2-11-31(36(46)38(48)40-23-34(45)52-25-26-12-5-3-6-13-26)41-37(47)32-22-30-24-43(32)39(49)35(28-15-7-4-8-16-28)42-33(44)21-27-14-9-17-29(20-27)50-18-10-19-51-30/h3,5-6,9,12-14,17,20,28,30-32,35H,2,4,7-8,10-11,15-16,18-19,21-25H2,1H3,(H,40,48)(H,41,47)(H,42,44)/t30-,31?,32+,35+/m1/s1 |
| InChIKey | MXLMCJDWRDDYKD-QTWNWOHFSA-N |
| XLogP | 2.78 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|