About 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid
5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 115422452) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 115422452 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1sc(-c2ccc3c(c2)CCCN3C)nc1C(=O)O |
| InChI | InChI=1S/C15H16N2O2S/c1-9-13(15(18)19)16-14(20-9)11-5-6-12-10(8-11)4-3-7-17(12)2/h5-6,8H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | FGLYUQJHRXCTLQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid (CID 115422452) is 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid is Cc1sc(-c2ccc3c(c2)CCCN3C)nc1C(=O)O.
What is the InChIKey of 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is FGLYUQJHRXCTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c1-9-13(15(18)19)16-14(20-9)11-5-6-12-10(8-11)4-3-7-17(12)2/h5-6,8H,3-4,7H2,1-2H3,(H,18,19).
What are the key properties of 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid?
5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 288.37 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 115422452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).