C13H9F2N3O2 — CID 115425095
6-amino-5-(2,5-difluoroanilino)-3H-1,3-benzoxazol-2-one (PubChem CID 115425095) has the molecular formula C13H9F2N3O2 and a molecular weight of 277.23 g/mol. Its IUPAC name is 6-amino-5-(2,5-difluoroanilino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(2,5-difluoroanilino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425095 |
| Molecular Formula | C13H9F2N3O2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-amino-5-(2,5-difluoroanilino)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C13H9F2N3O2/c14-6-1-2-7(15)9(3-6)17-10-5-11-12(4-8(10)16)20-13(19)18-11/h1-5,17H,16H2,(H,18,19) |
| InChIKey | GJQIZJAVLHZXOP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|