C26H6Cl4F12N8O4S2 — CID 11542523
N,N'-bis[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazol-5-yl]oxamide (PubChem CID 11542523) has the molecular formula C26H6Cl4F12N8O4S2 and a molecular weight of 928.31 g/mol. Its IUPAC name is N,N'-bis[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazol-5-yl]oxamide.
| Compound Name | N,N'-bis[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazol-5-yl]oxamide |
|---|---|
| PubChem CID | 11542523 |
| Molecular Formula | C26H6Cl4F12N8O4S2 |
| Molecular Weight | 928.31 g/mol |
| Exact Mass | 925.85 |
| IUPAC Name | N,N'-bis[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(trifluoromethylsulfinyl)pyrazol-5-yl]oxamide |
| SMILES | N#Cc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(NC(=O)C(=O)Nc2c(S(=O)C(F)(F)F)c(C#N)nn2-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1S(=O)C(F)(F)F |
| InChI | InChI=1S/C26H6Cl4F12N8O4S2/c27-9-1-7(23(31,32)33)2-10(28)15(9)49-19(17(13(5-43)47-49)55(53)25(37,38)39)45-21(51)22(52)46-20-18(56(54)26(40,41)42)14(6-44)48-50(20)16-11(29)3-8(4-12(16)30)24(34,35)36/h1-4H,(H,45,51)(H,46,52) |
| InChIKey | XNDQTEKXQSPVFE-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.31 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|