C14H12N2O3 — CID 115425878
6-amino-5-(2-methylphenoxy)-3H-1,3-benzoxazol-2-one (PubChem CID 115425878) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 6-amino-5-(2-methylphenoxy)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(2-methylphenoxy)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425878 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-amino-5-(2-methylphenoxy)-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1ccccc1Oc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C14H12N2O3/c1-8-4-2-3-5-11(8)18-12-7-10-13(6-9(12)15)19-14(17)16-10/h2-7H,15H2,1H3,(H,16,17) |
| InChIKey | WHZGVBODXMBWRU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|