3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid

C15H21NO4 — CID 115427019

IUPAC3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid
SMILESCCc1cccc(OCC(=O)NCC(C)(C)C(=O)O)c1
InChIInChI=1S/C15H21NO4/c1-4-11-6-5-7-12(8-11)20-9-13(17)16-10-15(2,3)14(18)19/h5-8H,4,9-10H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyIXXDISAZGPTBNG-UHFFFAOYSA-N
MW279.34 g/mol
LogP1.85
Rot. Bonds7

About 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid

3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 115427019) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid
PubChem CID115427019
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Name3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid
SMILESCCc1cccc(OCC(=O)NCC(C)(C)C(=O)O)c1
InChIInChI=1S/C15H21NO4/c1-4-11-6-5-7-12(8-11)20-9-13(17)16-10-15(2,3)14(18)19/h5-8H,4,9-10H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyIXXDISAZGPTBNG-UHFFFAOYSA-N
XLogP1.85
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 51.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid (CID 115427019) is 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid is CCc1cccc(OCC(=O)NCC(C)(C)C(=O)O)c1.
What is the InChIKey of 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid?
The InChIKey is IXXDISAZGPTBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-4-11-6-5-7-12(8-11)20-9-13(17)16-10-15(2,3)14(18)19/h5-8H,4,9-10H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid?
3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid has a molecular weight of 279.34 g/mol, XLogP of 1.85, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(3-ethylphenoxy)acetyl]amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 115427019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).