C13H13NO — CID 11542953
4,5-dimethyl-2-pyridin-3-ylphenol (PubChem CID 11542953) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4,5-dimethyl-2-pyridin-3-ylphenol.
| Compound Name | 4,5-dimethyl-2-pyridin-3-ylphenol |
|---|---|
| PubChem CID | 11542953 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4,5-dimethyl-2-pyridin-3-ylphenol |
| SMILES | Cc1cc(O)c(-c2cccnc2)cc1C |
| InChI | InChI=1S/C13H13NO/c1-9-6-12(13(15)7-10(9)2)11-4-3-5-14-8-11/h3-8,15H,1-2H3 |
| InChIKey | AXFJANUFWXXUTF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |