C10H20O4 — CID 11542987
(1S,2R,3S,4R,5R)-2-methyl-5-propan-2-ylcyclohexane-1,2,3,4-tetrol (PubChem CID 11542987) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-2-methyl-5-propan-2-ylcyclohexane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3S,4R,5R)-2-methyl-5-propan-2-ylcyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11542987 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (1S,2R,3S,4R,5R)-2-methyl-5-propan-2-ylcyclohexane-1,2,3,4-tetrol |
| SMILES | CC(C)[C@H]1C[C@H](O)[C@@](C)(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O4/c1-5(2)6-4-7(11)10(3,14)9(13)8(6)12/h5-9,11-14H,4H2,1-3H3/t6-,7+,8-,9+,10-/m1/s1 |
| InChIKey | YFASMKQYOXGOCQ-MQIGXGKASA-N |
| XLogP | -0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |