About 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine
1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine (PubChem CID 11543058) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine |
| PubChem CID | 11543058 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine |
| SMILES | NC1CCN(c2ccnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C12H16N4/c13-9-3-7-16(8-4-9)11-2-6-15-12-10(11)1-5-14-12/h1-2,5-6,9H,3-4,7-8,13H2,(H,14,15) |
| InChIKey | ZFBACGKIDNXYRK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine?
The IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine (CID 11543058) is 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine.
What is the SMILES notation for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine?
The canonical SMILES for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine is NC1CCN(c2ccnc3[nH]ccc23)CC1.
What is the InChIKey of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine?
The InChIKey is ZFBACGKIDNXYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c13-9-3-7-16(8-4-9)11-2-6-15-12-10(11)1-5-14-12/h1-2,5-6,9H,3-4,7-8,13H2,(H,14,15).
What are the key properties of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine?
1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine has a molecular weight of 216.29 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-4-amine is sourced from PubChem (CID 11543058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).