C12H16N2S — CID 11543100
4-(1,2,3,4,5,6-hexahydropentalen-1-ylmethyl)-1,3-dihydroimidazole-2-thione (PubChem CID 11543100) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-(1,2,3,4,5,6-hexahydropentalen-1-ylmethyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(1,2,3,4,5,6-hexahydropentalen-1-ylmethyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 11543100 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-(1,2,3,4,5,6-hexahydropentalen-1-ylmethyl)-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]cc(CC2CCC3=C2CCC3)[nH]1 |
| InChI | InChI=1S/C12H16N2S/c15-12-13-7-10(14-12)6-9-5-4-8-2-1-3-11(8)9/h7,9H,1-6H2,(H2,13,14,15) |
| InChIKey | LXRVODJEONQBGT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|