C12H21F3N2O4 — CID 115431187
2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]butanoic acid (PubChem CID 115431187) has the molecular formula C12H21F3N2O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 115431187 |
| Molecular Formula | C12H21F3N2O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-ethyl-2-[[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H21F3N2O4/c1-3-11(4-2,9(18)19)7-17-10(20)16-5-6-21-8-12(13,14)15/h3-8H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | KVYFHTLIFBZAHS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|