C14H22N2O3S — CID 115431290
2-ethyl-2-[[(4-methylthiophen-3-yl)methylcarbamoylamino]methyl]butanoic acid (PubChem CID 115431290) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-ethyl-2-[[(4-methylthiophen-3-yl)methylcarbamoylamino]methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[[(4-methylthiophen-3-yl)methylcarbamoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 115431290 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-ethyl-2-[[(4-methylthiophen-3-yl)methylcarbamoylamino]methyl]butanoic acid |
| SMILES | CCC(CC)(CNC(=O)NCc1cscc1C)C(=O)O |
| InChI | InChI=1S/C14H22N2O3S/c1-4-14(5-2,12(17)18)9-16-13(19)15-6-11-8-20-7-10(11)3/h7-8H,4-6,9H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | LHUVYDJSYIBAJF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |