C7H8ClF3O3 — CID 11543184
ethyl (2S)-2-chloro-4,4,4-trifluoro-2-methyl-3-oxobutanoate (PubChem CID 11543184) has the molecular formula C7H8ClF3O3 and a molecular weight of 232.58 g/mol. Its IUPAC name is ethyl (2S)-2-chloro-4,4,4-trifluoro-2-methyl-3-oxobutanoate.
| Compound Name | ethyl (2S)-2-chloro-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 11543184 |
| Molecular Formula | C7H8ClF3O3 |
| Molecular Weight | 232.58 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | ethyl (2S)-2-chloro-4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| SMILES | CCOC(=O)[C@@](C)(Cl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3O3/c1-3-14-5(13)6(2,8)4(12)7(9,10)11/h3H2,1-2H3/t6-/m0/s1 |
| InChIKey | PJUDKFLYTBVQDF-LURJTMIESA-N |
| XLogP | 1.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.58 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|