About 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid
1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 115432882) has the molecular formula C13H17N3O5
and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 115432882 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NCC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C13H17N3O5/c17-9-3-4-11(19)16(15-9)7-10(18)14-8-13(12(20)21)5-1-2-6-13/h3-4H,1-2,5-8H2,(H,14,18)(H,15,17)(H,20,21) |
| InChIKey | PLGAKLPMJSLOEY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid (CID 115432882) is 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid is O=C(Cn1[nH]c(=O)ccc1=O)NCC1(C(=O)O)CCCC1.
What is the InChIKey of 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid?
The InChIKey is PLGAKLPMJSLOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5/c17-9-3-4-11(19)16(15-9)7-10(18)14-8-13(12(20)21)5-1-2-6-13/h3-4H,1-2,5-8H2,(H,14,18)(H,15,17)(H,20,21).
What are the key properties of 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid?
1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid has a molecular weight of 295.29 g/mol, XLogP of -0.70, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]methyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 115432882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).