C8H14N2O3 — CID 115433058
1-[(carbamoylamino)methyl]cyclopentane-1-carboxylic acid (PubChem CID 115433058) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-[(carbamoylamino)methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(carbamoylamino)methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115433058 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-[(carbamoylamino)methyl]cyclopentane-1-carboxylic acid |
| SMILES | NC(=O)NCC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C8H14N2O3/c9-7(13)10-5-8(6(11)12)3-1-2-4-8/h1-5H2,(H,11,12)(H3,9,10,13) |
| InChIKey | JTGOODKCSLKKDP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |