C13H20O5 — CID 11543406
(1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-yn-1-ol (PubChem CID 11543406) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-yn-1-ol.
| Compound Name | (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 11543406 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1S)-1-[(2R,3R,5S,6S)-3-ethenyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-yn-1-ol |
| SMILES | C#C[C@H](O)[C@H]1O[C@](C)(OC)[C@@](C)(OC)O[C@@H]1C=C |
| InChI | InChI=1S/C13H20O5/c1-7-9(14)11-10(8-2)17-12(3,15-5)13(4,16-6)18-11/h1,8-11,14H,2H2,3-6H3/t9-,10+,11+,12-,13-/m0/s1 |
| InChIKey | QRMWSXJLVWUCOI-QWQWKMKNSA-N |
| XLogP | 0.68 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|