C14H16ClFN2O3 — CID 115434138
1-[[(4-chloro-3-fluorophenyl)carbamoylamino]methyl]cyclopentane-1-carboxylic acid (PubChem CID 115434138) has the molecular formula C14H16ClFN2O3 and a molecular weight of 314.74 g/mol. Its IUPAC name is 1-[[(4-chloro-3-fluorophenyl)carbamoylamino]methyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[(4-chloro-3-fluorophenyl)carbamoylamino]methyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 115434138 |
| Molecular Formula | C14H16ClFN2O3 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[[(4-chloro-3-fluorophenyl)carbamoylamino]methyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCC1)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H16ClFN2O3/c15-10-4-3-9(7-11(10)16)18-13(21)17-8-14(12(19)20)5-1-2-6-14/h3-4,7H,1-2,5-6,8H2,(H,19,20)(H2,17,18,21) |
| InChIKey | JBMGKOWMELEBSF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |