About 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide
2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide (PubChem CID 11543477) has the molecular formula C10H7ClF2N2O2
and a molecular weight of 260.63 g/mol. Its IUPAC name is 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide |
| PubChem CID | 11543477 |
| Molecular Formula | C10H7ClF2N2O2 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)C(F)(F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C10H7ClF2N2O2/c11-5-1-2-7-6(3-5)10(12,13)9(17)15(7)4-8(14)16/h1-3H,4H2,(H2,14,16) |
| InChIKey | ZTINVWDIBKUCBK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide?
The IUPAC name of 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide (CID 11543477) is 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide.
What is the SMILES notation for 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide?
The canonical SMILES for 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide is NC(=O)CN1C(=O)C(F)(F)c2cc(Cl)ccc21.
What is the InChIKey of 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide?
The InChIKey is ZTINVWDIBKUCBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClF2N2O2/c11-5-1-2-7-6(3-5)10(12,13)9(17)15(7)4-8(14)16/h1-3H,4H2,(H2,14,16).
What are the key properties of 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide?
2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide has a molecular weight of 260.63 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-3,3-difluoro-2-oxoindol-1-yl)acetamide is sourced from PubChem (CID 11543477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).