C18H26N2O — CID 115434974
[1-(aminomethyl)cyclopentyl]-(2-benzylpyrrolidin-1-yl)methanone (PubChem CID 115434974) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is [1-(aminomethyl)cyclopentyl]-(2-benzylpyrrolidin-1-yl)methanone.
| Compound Name | [1-(aminomethyl)cyclopentyl]-(2-benzylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 115434974 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | [1-(aminomethyl)cyclopentyl]-(2-benzylpyrrolidin-1-yl)methanone |
| SMILES | NCC1(C(=O)N2CCCC2Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C18H26N2O/c19-14-18(10-4-5-11-18)17(21)20-12-6-9-16(20)13-15-7-2-1-3-8-15/h1-3,7-8,16H,4-6,9-14,19H2 |
| InChIKey | YJDKGQMMTQCSPX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |