C13H18F3N3 — CID 11543626
5,7,8-trifluoro-1,4-di(propan-2-yl)-2,3-dihydropyrido[3,4-b]pyrazine (PubChem CID 11543626) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is 5,7,8-trifluoro-1,4-di(propan-2-yl)-2,3-dihydropyrido[3,4-b]pyrazine.
| Compound Name | 5,7,8-trifluoro-1,4-di(propan-2-yl)-2,3-dihydropyrido[3,4-b]pyrazine |
|---|---|
| PubChem CID | 11543626 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5,7,8-trifluoro-1,4-di(propan-2-yl)-2,3-dihydropyrido[3,4-b]pyrazine |
| SMILES | CC(C)N1CCN(C(C)C)c2c(F)c(F)nc(F)c21 |
| InChI | InChI=1S/C13H18F3N3/c1-7(2)18-5-6-19(8(3)4)11-10(18)9(14)12(15)17-13(11)16/h7-8H,5-6H2,1-4H3 |
| InChIKey | YUPBCBAMLNUSIF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|