About (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate
(4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate (PubChem CID 115436617) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate |
| PubChem CID | 115436617 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate |
| SMILES | CC1CCC(OC(=O)C2(CN)CCCCC2)CC1 |
| InChI | InChI=1S/C15H27NO2/c1-12-5-7-13(8-6-12)18-14(17)15(11-16)9-3-2-4-10-15/h12-13H,2-11,16H2,1H3 |
| InChIKey | NMFIOKGBZXWVRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate?
The IUPAC name of (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate (CID 115436617) is (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate?
The canonical SMILES for (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate is CC1CCC(OC(=O)C2(CN)CCCCC2)CC1.
What is the InChIKey of (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate?
The InChIKey is NMFIOKGBZXWVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-12-5-7-13(8-6-12)18-14(17)15(11-16)9-3-2-4-10-15/h12-13H,2-11,16H2,1H3.
What are the key properties of (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate?
(4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate has a molecular weight of 253.39 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl) 1-(aminomethyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 115436617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).