C14H18O6 — CID 11543732
methyl (3aS,6aS)-3a-(3-acetyloxypropyl)-2-oxo-4,6a-dihydro-3H-cyclopenta[b]furan-3-carboxylate (PubChem CID 11543732) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is methyl (3aS,6aS)-3a-(3-acetyloxypropyl)-2-oxo-4,6a-dihydro-3H-cyclopenta[b]furan-3-carboxylate.
| Compound Name | methyl (3aS,6aS)-3a-(3-acetyloxypropyl)-2-oxo-4,6a-dihydro-3H-cyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 11543732 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | methyl (3aS,6aS)-3a-(3-acetyloxypropyl)-2-oxo-4,6a-dihydro-3H-cyclopenta[b]furan-3-carboxylate |
| SMILES | COC(=O)C1C(=O)O[C@H]2C=CC[C@@]12CCCOC(C)=O |
| InChI | InChI=1S/C14H18O6/c1-9(15)19-8-4-7-14-6-3-5-10(14)20-13(17)11(14)12(16)18-2/h3,5,10-11H,4,6-8H2,1-2H3/t10-,11?,14-/m0/s1 |
| InChIKey | UTOYJQZCRAHQFN-PEMBBPQUSA-N |
| XLogP | 0.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|