About 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile
2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile (PubChem CID 11543776) has the molecular formula C16H15NO2S
and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile |
| PubChem CID | 11543776 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile |
| SMILES | CC(O)c1cc2c(s1)-c1ccc(OCC#N)cc1CC2 |
| InChI | InChI=1S/C16H15NO2S/c1-10(18)15-9-12-3-2-11-8-13(19-7-6-17)4-5-14(11)16(12)20-15/h4-5,8-10,18H,2-3,7H2,1H3 |
| InChIKey | OGDLYXQLQGCPMW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile?
The IUPAC name of 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile (CID 11543776) is 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile.
What is the SMILES notation for 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile?
The canonical SMILES for 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile is CC(O)c1cc2c(s1)-c1ccc(OCC#N)cc1CC2.
What is the InChIKey of 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile?
The InChIKey is OGDLYXQLQGCPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2S/c1-10(18)15-9-12-3-2-11-8-13(19-7-6-17)4-5-14(11)16(12)20-15/h4-5,8-10,18H,2-3,7H2,1H3.
What are the key properties of 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile?
2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile has a molecular weight of 285.37 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(1-hydroxyethyl)-4,5-dihydrobenzo[g][1]benzothiol-7-yl]oxy]acetonitrile is sourced from PubChem (CID 11543776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).