C13H26N4OS — CID 11543789
1,10-diethyl-6-sulfanylidene-1,4,7,10-tetrazacyclotridecan-5-one (PubChem CID 11543789) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is 1,10-diethyl-6-sulfanylidene-1,4,7,10-tetrazacyclotridecan-5-one.
| Compound Name | 1,10-diethyl-6-sulfanylidene-1,4,7,10-tetrazacyclotridecan-5-one |
|---|---|
| PubChem CID | 11543789 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1,10-diethyl-6-sulfanylidene-1,4,7,10-tetrazacyclotridecan-5-one |
| SMILES | CCN1CCCN(CC)CCNC(=S)C(=O)NCC1 |
| InChI | InChI=1S/C13H26N4OS/c1-3-16-8-5-9-17(4-2)11-7-15-13(19)12(18)14-6-10-16/h3-11H2,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | DLUSTVRYRGBYNO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|