C19H28O2 — CID 11543809
methyl (3aR,5E,9E,12aS)-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-1-carboxylate (PubChem CID 11543809) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is methyl (3aR,5E,9E,12aS)-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-1-carboxylate.
| Compound Name | methyl (3aR,5E,9E,12aS)-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-1-carboxylate |
|---|---|
| PubChem CID | 11543809 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | methyl (3aR,5E,9E,12aS)-3a,6,10-trimethyl-4,7,8,11,12,12a-hexahydro-3H-cyclopenta[11]annulene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@@]2(C)C/C=C(\C)CC/C=C(\C)CC[C@H]12 |
| InChI | InChI=1S/C19H28O2/c1-14-6-5-7-15(2)10-12-19(3)13-11-16(18(20)21-4)17(19)9-8-14/h6,10-11,17H,5,7-9,12-13H2,1-4H3/b14-6+,15-10+/t17-,19-/m1/s1 |
| InChIKey | CMCJSUYAUXZEGP-ZSJFPXLKSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|