C16H13ClFNO — CID 11543830
5-(5-chloro-2-fluorophenyl)-3-methyl-3-phenyl-2H-1,2-oxazole (PubChem CID 11543830) has the molecular formula C16H13ClFNO and a molecular weight of 289.74 g/mol. Its IUPAC name is 5-(5-chloro-2-fluorophenyl)-3-methyl-3-phenyl-2H-1,2-oxazole.
| Compound Name | 5-(5-chloro-2-fluorophenyl)-3-methyl-3-phenyl-2H-1,2-oxazole |
|---|---|
| PubChem CID | 11543830 |
| Molecular Formula | C16H13ClFNO |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-(5-chloro-2-fluorophenyl)-3-methyl-3-phenyl-2H-1,2-oxazole |
| SMILES | CC1(c2ccccc2)C=C(c2cc(Cl)ccc2F)ON1 |
| InChI | InChI=1S/C16H13ClFNO/c1-16(11-5-3-2-4-6-11)10-15(20-19-16)13-9-12(17)7-8-14(13)18/h2-10,19H,1H3 |
| InChIKey | CXWRPBXBCYCWHY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |